C14H20F2N2O2 — CID 163284116
prop-2-enyl 1-[[(3aS,6aR)-6,6-difluoro-2,3,3a,4,5,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]cyclopropane-1-carboxylate (PubChem CID 163284116) has the molecular formula C14H20F2N2O2 and a molecular weight of 286.32 g/mol. Its IUPAC name is prop-2-enyl 1-[[(3aS,6aR)-6,6-difluoro-2,3,3a,4,5,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]cyclopropane-1-carboxylate.
| Compound Name | prop-2-enyl 1-[[(3aS,6aR)-6,6-difluoro-2,3,3a,4,5,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 163284116 |
| Molecular Formula | C14H20F2N2O2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | prop-2-enyl 1-[[(3aS,6aR)-6,6-difluoro-2,3,3a,4,5,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]cyclopropane-1-carboxylate |
| SMILES | C=CCOC(=O)C1(CN2CC[C@@H]3NCC(F)(F)[C@@H]32)CC1 |
| InChI | InChI=1S/C14H20F2N2O2/c1-2-7-20-12(19)13(4-5-13)9-18-6-3-10-11(18)14(15,16)8-17-10/h2,10-11,17H,1,3-9H2/t10-,11+/m0/s1 |
| InChIKey | BXAREIHTPXLTHN-WDEREUQCSA-N |
| XLogP | 1.18 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|