C14H16F2N4O2 — CID 163284123
prop-2-enyl 2-[(3aS,6aR)-6,6-difluoro-2,3,3a,4,5,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]pyrimidine-5-carboxylate (PubChem CID 163284123) has the molecular formula C14H16F2N4O2 and a molecular weight of 310.30 g/mol. Its IUPAC name is prop-2-enyl 2-[(3aS,6aR)-6,6-difluoro-2,3,3a,4,5,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]pyrimidine-5-carboxylate.
| Compound Name | prop-2-enyl 2-[(3aS,6aR)-6,6-difluoro-2,3,3a,4,5,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 163284123 |
| Molecular Formula | C14H16F2N4O2 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | prop-2-enyl 2-[(3aS,6aR)-6,6-difluoro-2,3,3a,4,5,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]pyrimidine-5-carboxylate |
| SMILES | C=CCOC(=O)c1cnc(N2CC[C@@H]3NCC(F)(F)[C@@H]32)nc1 |
| InChI | InChI=1S/C14H16F2N4O2/c1-2-5-22-12(21)9-6-17-13(18-7-9)20-4-3-10-11(20)14(15,16)8-19-10/h2,6-7,10-11,19H,1,3-5,8H2/t10-,11+/m0/s1 |
| InChIKey | FFSMNQBGXWBZFC-WDEREUQCSA-N |
| XLogP | 1.01 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|