C20H32 — CID 163285723
(1S,4E,9R,11S)-4,11-dimethyl-8-methylidene-11-(4-methylpent-3-enyl)bicyclo[7.2.0]undec-4-ene (PubChem CID 163285723) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is (1S,4E,9R,11S)-4,11-dimethyl-8-methylidene-11-(4-methylpent-3-enyl)bicyclo[7.2.0]undec-4-ene.
| Compound Name | (1S,4E,9R,11S)-4,11-dimethyl-8-methylidene-11-(4-methylpent-3-enyl)bicyclo[7.2.0]undec-4-ene |
|---|---|
| PubChem CID | 163285723 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | (1S,4E,9R,11S)-4,11-dimethyl-8-methylidene-11-(4-methylpent-3-enyl)bicyclo[7.2.0]undec-4-ene |
| SMILES | C=C1CC/C=C(\C)CC[C@H]2[C@H]1C[C@]2(C)CCC=C(C)C |
| InChI | InChI=1S/C20H32/c1-15(2)8-7-13-20(5)14-18-17(4)10-6-9-16(3)11-12-19(18)20/h8-9,18-19H,4,6-7,10-14H2,1-3,5H3/b16-9+/t18-,19-,20-/m0/s1 |
| InChIKey | ZMOFGHYLDNTJKF-JGSSICMWSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|