C27H29N5O3 — CID 163286343
3-[[5-[2-(furan-2-yl)-1-(2-methoxyethyl)imidazo[4,5-c]quinolin-8-yl]-2-pyridinyl]oxy]-N,N-dimethylpropan-1-amine (PubChem CID 163286343) has the molecular formula C27H29N5O3 and a molecular weight of 471.56 g/mol. Its IUPAC name is 3-[[5-[2-(furan-2-yl)-1-(2-methoxyethyl)imidazo[4,5-c]quinolin-8-yl]-2-pyridinyl]oxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[[5-[2-(furan-2-yl)-1-(2-methoxyethyl)imidazo[4,5-c]quinolin-8-yl]-2-pyridinyl]oxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 163286343 |
| Molecular Formula | C27H29N5O3 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 3-[[5-[2-(furan-2-yl)-1-(2-methoxyethyl)imidazo[4,5-c]quinolin-8-yl]-2-pyridinyl]oxy]-N,N-dimethylpropan-1-amine |
| SMILES | COCCn1c(-c2ccco2)nc2cnc3ccc(-c4ccc(OCCCN(C)C)nc4)cc3c21 |
| InChI | InChI=1S/C27H29N5O3/c1-31(2)11-5-14-35-25-10-8-20(17-29-25)19-7-9-22-21(16-19)26-23(18-28-22)30-27(24-6-4-13-34-24)32(26)12-15-33-3/h4,6-10,13,16-18H,5,11-12,14-15H2,1-3H3 |
| InChIKey | HODRACUOUKYTME-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 78.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|