C18H18F2N4O2 — CID 163289230
3-but-1-ynyl-4-[(1S,2S)-2-(difluoromethyl)cyclopropyl]-6-(2,4-dimethoxypyrimidin-5-yl)pyridazine (PubChem CID 163289230) has the molecular formula C18H18F2N4O2 and a molecular weight of 360.36 g/mol. Its IUPAC name is 3-but-1-ynyl-4-[(1S,2S)-2-(difluoromethyl)cyclopropyl]-6-(2,4-dimethoxypyrimidin-5-yl)pyridazine.
| Compound Name | 3-but-1-ynyl-4-[(1S,2S)-2-(difluoromethyl)cyclopropyl]-6-(2,4-dimethoxypyrimidin-5-yl)pyridazine |
|---|---|
| PubChem CID | 163289230 |
| Molecular Formula | C18H18F2N4O2 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 3-but-1-ynyl-4-[(1S,2S)-2-(difluoromethyl)cyclopropyl]-6-(2,4-dimethoxypyrimidin-5-yl)pyridazine |
| SMILES | CCC#Cc1nnc(-c2cnc(OC)nc2OC)cc1[C@H]1C[C@@H]1C(F)F |
| InChI | InChI=1S/C18H18F2N4O2/c1-4-5-6-14-11(10-7-12(10)16(19)20)8-15(24-23-14)13-9-21-18(26-3)22-17(13)25-2/h8-10,12,16H,4,7H2,1-3H3/t10-,12+/m1/s1 |
| InChIKey | APBFXIQQAWMIQZ-PWSUYJOCSA-N |
| XLogP | 3.08 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|