C17H15FN4O2 — CID 163289234
5-[6-(2-cyclopropylethynyl)-5-[(1S,2S)-2-(fluoromethyl)cyclopropyl]pyridazin-3-yl]-1H-pyrimidine-2,4-dione (PubChem CID 163289234) has the molecular formula C17H15FN4O2 and a molecular weight of 326.33 g/mol. Its IUPAC name is 5-[6-(2-cyclopropylethynyl)-5-[(1S,2S)-2-(fluoromethyl)cyclopropyl]pyridazin-3-yl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[6-(2-cyclopropylethynyl)-5-[(1S,2S)-2-(fluoromethyl)cyclopropyl]pyridazin-3-yl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 163289234 |
| Molecular Formula | C17H15FN4O2 |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 5-[6-(2-cyclopropylethynyl)-5-[(1S,2S)-2-(fluoromethyl)cyclopropyl]pyridazin-3-yl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(-c2cc([C@H]3C[C@@H]3CF)c(C#CC3CC3)nn2)c(=O)[nH]1 |
| InChI | InChI=1S/C17H15FN4O2/c18-7-10-5-11(10)12-6-15(13-8-19-17(24)20-16(13)23)22-21-14(12)4-3-9-1-2-9/h6,8-11H,1-2,5,7H2,(H2,19,20,23,24)/t10-,11+/m1/s1 |
| InChIKey | NKHYNHXZHYGMEC-MNOVXSKESA-N |
| XLogP | 1.35 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|