About spiro[7H-furo[3,2-d]pyrimidine-6,4'-piperidine]
spiro[7H-furo[3,2-d]pyrimidine-6,4'-piperidine] (PubChem CID 163289339) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is spiro[7H-furo[3,2-d]pyrimidine-6,4'-piperidine].
Molecular Properties
| Compound Name | spiro[7H-furo[3,2-d]pyrimidine-6,4'-piperidine] |
| PubChem CID | 163289339 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | spiro[7H-furo[3,2-d]pyrimidine-6,4'-piperidine] |
| SMILES | c1ncc2c(n1)CC1(CCNCC1)O2 |
| InChI | InChI=1S/C10H13N3O/c1-3-11-4-2-10(1)5-8-9(14-10)6-12-7-13-8/h6-7,11H,1-5H2 |
| InChIKey | MGDDWCSXXBTPBT-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze spiro[7H-furo[3,2-d]pyrimidine-6,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[7H-furo[3,2-d]pyrimidine-6,4'-piperidine]?
The IUPAC name of spiro[7H-furo[3,2-d]pyrimidine-6,4'-piperidine] (CID 163289339) is spiro[7H-furo[3,2-d]pyrimidine-6,4'-piperidine].
What is the SMILES notation for spiro[7H-furo[3,2-d]pyrimidine-6,4'-piperidine]?
The canonical SMILES for spiro[7H-furo[3,2-d]pyrimidine-6,4'-piperidine] is c1ncc2c(n1)CC1(CCNCC1)O2.
What is the InChIKey of spiro[7H-furo[3,2-d]pyrimidine-6,4'-piperidine]?
The InChIKey is MGDDWCSXXBTPBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c1-3-11-4-2-10(1)5-8-9(14-10)6-12-7-13-8/h6-7,11H,1-5H2.
What are the key properties of spiro[7H-furo[3,2-d]pyrimidine-6,4'-piperidine]?
spiro[7H-furo[3,2-d]pyrimidine-6,4'-piperidine] has a molecular weight of 191.23 g/mol, XLogP of 0.53, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[7H-furo[3,2-d]pyrimidine-6,4'-piperidine] is sourced from PubChem (CID 163289339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).