C11H12N4O3 — CID 163289689
methyl 2-(1-methyl-5-pyrimidin-5-ylpyrazol-3-yl)oxyacetate (PubChem CID 163289689) has the molecular formula C11H12N4O3 and a molecular weight of 248.24 g/mol. Its IUPAC name is methyl 2-(1-methyl-5-pyrimidin-5-ylpyrazol-3-yl)oxyacetate.
| Compound Name | methyl 2-(1-methyl-5-pyrimidin-5-ylpyrazol-3-yl)oxyacetate |
|---|---|
| PubChem CID | 163289689 |
| Molecular Formula | C11H12N4O3 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | methyl 2-(1-methyl-5-pyrimidin-5-ylpyrazol-3-yl)oxyacetate |
| SMILES | COC(=O)COc1cc(-c2cncnc2)n(C)n1 |
| InChI | InChI=1S/C11H12N4O3/c1-15-9(8-4-12-7-13-5-8)3-10(14-15)18-6-11(16)17-2/h3-5,7H,6H2,1-2H3 |
| InChIKey | XFIAVYGCROGBGL-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |