About CID 163289971
CID 163289971 (PubChem CID 163289971) has the molecular formula C14H16N2Si-
and a molecular weight of 240.38 g/mol.
Molecular Properties
| Compound Name | CID 163289971 |
| PubChem CID | 163289971 |
| Molecular Formula | C14H16N2Si- |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | — |
| SMILES | C[Si-]1(C)c2ccccc2N(N)c2ccccc21 |
| InChI | InChI=1S/C14H16N2Si/c1-17(2)13-9-5-3-7-11(13)16(15)12-8-4-6-10-14(12)17/h3-10H,15H2,1-2H3/q-1 |
| InChIKey | ZLPZHGSPSWYURO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze CID 163289971 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163289971?
The IUPAC name of CID 163289971 (CID 163289971) is not available.
What is the SMILES notation for CID 163289971?
The canonical SMILES for CID 163289971 is C[Si-]1(C)c2ccccc2N(N)c2ccccc21.
What is the InChIKey of CID 163289971?
The InChIKey is ZLPZHGSPSWYURO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2Si/c1-17(2)13-9-5-3-7-11(13)16(15)12-8-4-6-10-14(12)17/h3-10H,15H2,1-2H3/q-1.
What are the key properties of CID 163289971?
CID 163289971 has a molecular weight of 240.38 g/mol, XLogP of 1.83, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163289971 is sourced from PubChem (CID 163289971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).