C39H67N3O5 — CID 163290122
butane;(E)-N-[1-[2-ethoxy-5-[1-[3-(4-hydroxybutoxy)azetidin-1-yl]oxyethenyl]phenyl]-2-methylbut-1-enyl]-4-imino-2,3-dimethylhept-2-enamide (PubChem CID 163290122) has the molecular formula C39H67N3O5 and a molecular weight of 657.98 g/mol. Its IUPAC name is butane;(E)-N-[1-[2-ethoxy-5-[1-[3-(4-hydroxybutoxy)azetidin-1-yl]oxyethenyl]phenyl]-2-methylbut-1-enyl]-4-imino-2,3-dimethylhept-2-enamide.
| Compound Name | butane;(E)-N-[1-[2-ethoxy-5-[1-[3-(4-hydroxybutoxy)azetidin-1-yl]oxyethenyl]phenyl]-2-methylbut-1-enyl]-4-imino-2,3-dimethylhept-2-enamide |
|---|---|
| PubChem CID | 163290122 |
| Molecular Formula | C39H67N3O5 |
| Molecular Weight | 657.98 g/mol |
| Exact Mass | 657.51 |
| IUPAC Name | butane;(E)-N-[1-[2-ethoxy-5-[1-[3-(4-hydroxybutoxy)azetidin-1-yl]oxyethenyl]phenyl]-2-methylbut-1-enyl]-4-imino-2,3-dimethylhept-2-enamide |
| SMILES | CCCC.CCCC.[H]/N=C(CCC)/C(C)=C(\C)C(=O)NC(=C(C)CC)c1cc(C(=C)ON2CC(OCCCCO)C2)ccc1OCC |
| InChI | InChI=1S/C31H47N3O5.2C4H10/c1-8-13-28(32)22(5)23(6)31(36)33-30(21(4)9-2)27-18-25(14-15-29(27)37-10-3)24(7)39-34-19-26(20-34)38-17-12-11-16-35;2*1-3-4-2/h14-15,18,26,32,35H,7-13,16-17,19-20H2,1-6H3,(H,33,36);2*3-4H2,1-2H3/b23-22+,30-21?,32-28+;; |
| InChIKey | GJWQSFFFDCTFAW-VVQVYSEZSA-N |
| XLogP | 9.49 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.98 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|