C16H18F3N5O2S — CID 163290512
2-methylsulfonyl-4-N-piperidin-4-yl-6-N-(3,4,5-trifluorophenyl)pyrimidine-4,6-diamine (PubChem CID 163290512) has the molecular formula C16H18F3N5O2S and a molecular weight of 401.41 g/mol. Its IUPAC name is 2-methylsulfonyl-4-N-piperidin-4-yl-6-N-(3,4,5-trifluorophenyl)pyrimidine-4,6-diamine.
| Compound Name | 2-methylsulfonyl-4-N-piperidin-4-yl-6-N-(3,4,5-trifluorophenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 163290512 |
| Molecular Formula | C16H18F3N5O2S |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 2-methylsulfonyl-4-N-piperidin-4-yl-6-N-(3,4,5-trifluorophenyl)pyrimidine-4,6-diamine |
| SMILES | CS(=O)(=O)c1nc(Nc2cc(F)c(F)c(F)c2)cc(NC2CCNCC2)n1 |
| InChI | InChI=1S/C16H18F3N5O2S/c1-27(25,26)16-23-13(21-9-2-4-20-5-3-9)8-14(24-16)22-10-6-11(17)15(19)12(18)7-10/h6-9,20H,2-5H2,1H3,(H2,21,22,23,24) |
| InChIKey | ILYYYBBTCUHTMM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|