C16H19FN2O4 — CID 163290592
3-[(3E)-3-[(Z)-but-2-enylidene]-4-methylidene-2,5-dioxopyrrolidin-1-yl]-3-fluoropiperidine-2,6-dione;ethane (PubChem CID 163290592) has the molecular formula C16H19FN2O4 and a molecular weight of 322.34 g/mol. Its IUPAC name is 3-[(3E)-3-[(Z)-but-2-enylidene]-4-methylidene-2,5-dioxopyrrolidin-1-yl]-3-fluoropiperidine-2,6-dione;ethane.
| Compound Name | 3-[(3E)-3-[(Z)-but-2-enylidene]-4-methylidene-2,5-dioxopyrrolidin-1-yl]-3-fluoropiperidine-2,6-dione;ethane |
|---|---|
| PubChem CID | 163290592 |
| Molecular Formula | C16H19FN2O4 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 3-[(3E)-3-[(Z)-but-2-enylidene]-4-methylidene-2,5-dioxopyrrolidin-1-yl]-3-fluoropiperidine-2,6-dione;ethane |
| SMILES | C=C1C(=O)N(C2(F)CCC(=O)NC2=O)C(=O)/C1=C/C=C\C.CC |
| InChI | InChI=1S/C14H13FN2O4.C2H6/c1-3-4-5-9-8(2)11(19)17(12(9)20)14(15)7-6-10(18)16-13(14)21;1-2/h3-5H,2,6-7H2,1H3,(H,16,18,21);1-2H3/b4-3-,9-5+; |
| InChIKey | RWSKQDIEOZHRIX-PIJLWJNCSA-N |
| XLogP | 1.54 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|