C26H26N6O2 — CID 163290845
N-(6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-yl)-7-(4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazin-7-yl)quinazolin-2-amine (PubChem CID 163290845) has the molecular formula C26H26N6O2 and a molecular weight of 454.53 g/mol. Its IUPAC name is N-(6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-yl)-7-(4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazin-7-yl)quinazolin-2-amine.
| Compound Name | N-(6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-yl)-7-(4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazin-7-yl)quinazolin-2-amine |
|---|---|
| PubChem CID | 163290845 |
| Molecular Formula | C26H26N6O2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | N-(6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-yl)-7-(4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazin-7-yl)quinazolin-2-amine |
| SMILES | COc1cc2c(cc1Nc1ncc3ccc(-c4cnc5c(c4)OCCN5C)cc3n1)CNCC2 |
| InChI | InChI=1S/C26H26N6O2/c1-32-7-8-34-24-12-20(15-28-25(24)32)16-3-4-18-14-29-26(30-21(18)9-16)31-22-10-19-13-27-6-5-17(19)11-23(22)33-2/h3-4,9-12,14-15,27H,5-8,13H2,1-2H3,(H,29,30,31) |
| InChIKey | IUECPFSRGQPPCG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |