C29H32FN7O — CID 163290846
7-(3,8-dimethyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-6-fluoro-2-N-(2-propan-2-yl-3,4-dihydro-1H-isoquinolin-7-yl)quinazoline-2,5-diamine (PubChem CID 163290846) has the molecular formula C29H32FN7O and a molecular weight of 513.62 g/mol. Its IUPAC name is 7-(3,8-dimethyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-6-fluoro-2-N-(2-propan-2-yl-3,4-dihydro-1H-isoquinolin-7-yl)quinazoline-2,5-diamine.
| Compound Name | 7-(3,8-dimethyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-6-fluoro-2-N-(2-propan-2-yl-3,4-dihydro-1H-isoquinolin-7-yl)quinazoline-2,5-diamine |
|---|---|
| PubChem CID | 163290846 |
| Molecular Formula | C29H32FN7O |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | 7-(3,8-dimethyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-6-fluoro-2-N-(2-propan-2-yl-3,4-dihydro-1H-isoquinolin-7-yl)quinazoline-2,5-diamine |
| SMILES | Cc1c(-c2cc3nc(Nc4ccc5c(c4)CN(C(C)C)CC5)ncc3c(N)c2F)cnc2c1NCC(C)O2 |
| InChI | InChI=1S/C29H32FN7O/c1-15(2)37-8-7-18-5-6-20(9-19(18)14-37)35-29-34-13-23-24(36-29)10-21(25(30)26(23)31)22-12-33-28-27(17(22)4)32-11-16(3)38-28/h5-6,9-10,12-13,15-16,32H,7-8,11,14,31H2,1-4H3,(H,34,35,36) |
| InChIKey | RKTMKSARXKXGFO-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|