C28H30FN7O — CID 163290889
6-fluoro-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-2-N-(2,3,3-trimethyl-1,4-dihydroisoquinolin-7-yl)quinazoline-2,5-diamine (PubChem CID 163290889) has the molecular formula C28H30FN7O and a molecular weight of 499.59 g/mol. Its IUPAC name is 6-fluoro-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-2-N-(2,3,3-trimethyl-1,4-dihydroisoquinolin-7-yl)quinazoline-2,5-diamine.
| Compound Name | 6-fluoro-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-2-N-(2,3,3-trimethyl-1,4-dihydroisoquinolin-7-yl)quinazoline-2,5-diamine |
|---|---|
| PubChem CID | 163290889 |
| Molecular Formula | C28H30FN7O |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | 6-fluoro-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-2-N-(2,3,3-trimethyl-1,4-dihydroisoquinolin-7-yl)quinazoline-2,5-diamine |
| SMILES | Cc1c(-c2cc3nc(Nc4ccc5c(c4)CN(C)C(C)(C)C5)ncc3c(N)c2F)cnc2c1NCCO2 |
| InChI | InChI=1S/C28H30FN7O/c1-15-20(12-32-26-25(15)31-7-8-37-26)19-10-22-21(24(30)23(19)29)13-33-27(35-22)34-18-6-5-16-11-28(2,3)36(4)14-17(16)9-18/h5-6,9-10,12-13,31H,7-8,11,14,30H2,1-4H3,(H,33,34,35) |
| InChIKey | GUTMFRLDYJULFK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|