C17H24BrNO4 — CID 163290959
methyl 4-[[1-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]butanoate (PubChem CID 163290959) has the molecular formula C17H24BrNO4 and a molecular weight of 386.29 g/mol. Its IUPAC name is methyl 4-[[1-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]butanoate.
| Compound Name | methyl 4-[[1-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]butanoate |
|---|---|
| PubChem CID | 163290959 |
| Molecular Formula | C17H24BrNO4 |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | methyl 4-[[1-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(C(=O)OC(C)(C)C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H24BrNO4/c1-17(2,3)23-16(21)15(12-7-9-13(18)10-8-12)19-11-5-6-14(20)22-4/h7-10,15,19H,5-6,11H2,1-4H3 |
| InChIKey | FQWGDSNKRAHQAK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|