C27H28FN7O2 — CID 163291008
6-fluoro-2-N-(7-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine (PubChem CID 163291008) has the molecular formula C27H28FN7O2 and a molecular weight of 501.57 g/mol. Its IUPAC name is 6-fluoro-2-N-(7-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine.
| Compound Name | 6-fluoro-2-N-(7-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine |
|---|---|
| PubChem CID | 163291008 |
| Molecular Formula | C27H28FN7O2 |
| Molecular Weight | 501.57 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | 6-fluoro-2-N-(7-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine |
| SMILES | COc1cc2c(cc1Nc1ncc3c(N)c(F)c(-c4cnc5c(c4C)NCCO5)cc3n1)CCN(C)C2 |
| InChI | InChI=1S/C27H28FN7O2/c1-14-18(11-31-26-25(14)30-5-7-37-26)17-10-20-19(24(29)23(17)28)12-32-27(33-20)34-21-8-15-4-6-35(2)13-16(15)9-22(21)36-3/h8-12,30H,4-7,13,29H2,1-3H3,(H,32,33,34) |
| InChIKey | JMBZWJCPSZOCHG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 110.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.57 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|