C71H140N4O6S2 — CID 163292505
2-[4-[2-[3-[bis[(Z)-2-hydroxyoctadec-9-enyl]amino]propyldisulfanyl]ethyl]piperazin-1-yl]ethyl 4-[bis(2-hydroxydecyl)amino]butanoate (PubChem CID 163292505) has the molecular formula C71H140N4O6S2 and a molecular weight of 1210.06 g/mol. Its IUPAC name is 2-[4-[2-[3-[bis[(Z)-2-hydroxyoctadec-9-enyl]amino]propyldisulfanyl]ethyl]piperazin-1-yl]ethyl 4-[bis(2-hydroxydecyl)amino]butanoate.
| Compound Name | 2-[4-[2-[3-[bis[(Z)-2-hydroxyoctadec-9-enyl]amino]propyldisulfanyl]ethyl]piperazin-1-yl]ethyl 4-[bis(2-hydroxydecyl)amino]butanoate |
|---|---|
| PubChem CID | 163292505 |
| Molecular Formula | C71H140N4O6S2 |
| Molecular Weight | 1210.06 g/mol |
| Exact Mass | 1209.02 |
| IUPAC Name | 2-[4-[2-[3-[bis[(Z)-2-hydroxyoctadec-9-enyl]amino]propyldisulfanyl]ethyl]piperazin-1-yl]ethyl 4-[bis(2-hydroxydecyl)amino]butanoate |
| SMILES | CCCCCCCC/C=C\CCCCCCC(O)CN(CCCSSCCN1CCN(CCOC(=O)CCCN(CC(O)CCCCCCCC)CC(O)CCCCCCCC)CC1)CC(O)CCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C71H140N4O6S2/c1-5-9-13-17-21-23-25-27-29-31-33-35-39-43-49-69(78)65-75(66-70(79)50-44-40-36-34-32-30-28-26-24-22-18-14-10-6-2)53-46-61-82-83-62-59-73-56-54-72(55-57-73)58-60-81-71(80)51-45-52-74(63-67(76)47-41-37-19-15-11-7-3)64-68(77)48-42-38-20-16-12-8-4/h27-30,67-70,76-79H,5-26,31-66H2,1-4H3/b29-27-,30-28- |
| InChIKey | MRPSKEXDEDNUKU-ZUELCTOOSA-N |
| XLogP | 17.54 |
| TPSA | 120.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 65 |
| Heavy Atoms | 83 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1210.06 |
| LogP ≤ 5 | 17.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|