C17H22N2O2 — CID 163292969
4-acetyl-3-cyclohexyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one (PubChem CID 163292969) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is 4-acetyl-3-cyclohexyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one.
| Compound Name | 4-acetyl-3-cyclohexyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 163292969 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 4-acetyl-3-cyclohexyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
| SMILES | CC(=O)N1Cc2ccccc2NC(=O)C1C1CCCCC1 |
| InChI | InChI=1S/C17H22N2O2/c1-12(20)19-11-14-9-5-6-10-15(14)18-17(21)16(19)13-7-3-2-4-8-13/h5-6,9-10,13,16H,2-4,7-8,11H2,1H3,(H,18,21) |
| InChIKey | SLOJDKZQXVYTGF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |