C20H20N4O2 — CID 163293095
phenyl (3S)-N-cyano-2-oxo-3-propan-2-yl-3,5-dihydro-1H-1,4-benzodiazepine-4-carboximidate (PubChem CID 163293095) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is phenyl (3S)-N-cyano-2-oxo-3-propan-2-yl-3,5-dihydro-1H-1,4-benzodiazepine-4-carboximidate.
| Compound Name | phenyl (3S)-N-cyano-2-oxo-3-propan-2-yl-3,5-dihydro-1H-1,4-benzodiazepine-4-carboximidate |
|---|---|
| PubChem CID | 163293095 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | phenyl (3S)-N-cyano-2-oxo-3-propan-2-yl-3,5-dihydro-1H-1,4-benzodiazepine-4-carboximidate |
| SMILES | CC(C)[C@H]1C(=O)Nc2ccccc2CN1/C(=N/C#N)Oc1ccccc1 |
| InChI | InChI=1S/C20H20N4O2/c1-14(2)18-19(25)23-17-11-7-6-8-15(17)12-24(18)20(22-13-21)26-16-9-4-3-5-10-16/h3-11,14,18H,12H2,1-2H3,(H,23,25)/b22-20-/t18-/m0/s1 |
| InChIKey | BFNUVEYVPRYJGW-BKBKCADHSA-N |
| XLogP | 3.38 |
| TPSA | 77.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|