C31H46N2S — CID 163293439
2-methyl-4-[3-[3-[3-(methylamino)but-3-enyl]phenyl]propyl]benzenethiol;2-[(3S)-pent-1-en-3-yl]piperidine (PubChem CID 163293439) has the molecular formula C31H46N2S and a molecular weight of 478.79 g/mol. Its IUPAC name is 2-methyl-4-[3-[3-[3-(methylamino)but-3-enyl]phenyl]propyl]benzenethiol;2-[(3S)-pent-1-en-3-yl]piperidine.
| Compound Name | 2-methyl-4-[3-[3-[3-(methylamino)but-3-enyl]phenyl]propyl]benzenethiol;2-[(3S)-pent-1-en-3-yl]piperidine |
|---|---|
| PubChem CID | 163293439 |
| Molecular Formula | C31H46N2S |
| Molecular Weight | 478.79 g/mol |
| Exact Mass | 478.34 |
| IUPAC Name | 2-methyl-4-[3-[3-[3-(methylamino)but-3-enyl]phenyl]propyl]benzenethiol;2-[(3S)-pent-1-en-3-yl]piperidine |
| SMILES | C=C(CCc1cccc(CCCc2ccc(S)c(C)c2)c1)NC.C=C[C@H](CC)C1CCCCN1 |
| InChI | InChI=1S/C21H27NS.C10H19N/c1-16-14-19(12-13-21(16)23)8-4-6-18-7-5-9-20(15-18)11-10-17(2)22-3;1-3-9(4-2)10-7-5-6-8-11-10/h5,7,9,12-15,22-23H,2,4,6,8,10-11H2,1,3H3;3,9-11H,1,4-8H2,2H3/t;9-,10?/m.1/s1 |
| InChIKey | STXWWBUZCSSNRK-SHOBTPENSA-N |
| XLogP | 7.47 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.79 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|