C17H12Cl2F3N5O4 — CID 163293507
6-amino-2-[3,5-dichloro-4-[[6-oxo-1-(1,1,1-trifluoropropan-2-yl)-3-pyridinyl]oxy]phenyl]-1,2,4-triazine-3,5-dione (PubChem CID 163293507) has the molecular formula C17H12Cl2F3N5O4 and a molecular weight of 478.21 g/mol. Its IUPAC name is 6-amino-2-[3,5-dichloro-4-[[6-oxo-1-(1,1,1-trifluoropropan-2-yl)-3-pyridinyl]oxy]phenyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 6-amino-2-[3,5-dichloro-4-[[6-oxo-1-(1,1,1-trifluoropropan-2-yl)-3-pyridinyl]oxy]phenyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 163293507 |
| Molecular Formula | C17H12Cl2F3N5O4 |
| Molecular Weight | 478.21 g/mol |
| Exact Mass | 477.02 |
| IUPAC Name | 6-amino-2-[3,5-dichloro-4-[[6-oxo-1-(1,1,1-trifluoropropan-2-yl)-3-pyridinyl]oxy]phenyl]-1,2,4-triazine-3,5-dione |
| SMILES | CC(n1cc(Oc2c(Cl)cc(-n3nc(N)c(=O)[nH]c3=O)cc2Cl)ccc1=O)C(F)(F)F |
| InChI | InChI=1S/C17H12Cl2F3N5O4/c1-7(17(20,21)22)26-6-9(2-3-12(26)28)31-13-10(18)4-8(5-11(13)19)27-16(30)24-15(29)14(23)25-27/h2-7H,1H3,(H2,23,25)(H,24,29,30) |
| InChIKey | UBUWTYYBBXQSOC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.21 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |