About 5-(4-amino-2,6-dichlorophenoxy)-4-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one
5-(4-amino-2,6-dichlorophenoxy)-4-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one (PubChem CID 163293623) has the molecular formula C16H11Cl2FN2O2
and a molecular weight of 353.18 g/mol. Its IUPAC name is 5-(4-amino-2,6-dichlorophenoxy)-4-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one.
Molecular Properties
| Compound Name | 5-(4-amino-2,6-dichlorophenoxy)-4-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one |
| PubChem CID | 163293623 |
| Molecular Formula | C16H11Cl2FN2O2 |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 5-(4-amino-2,6-dichlorophenoxy)-4-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one |
| SMILES | Nc1cc(Cl)c(Oc2ccc3c(c2F)C2(CC2)C(=O)N3)c(Cl)c1 |
| InChI | InChI=1S/C16H11Cl2FN2O2/c17-8-5-7(20)6-9(18)14(8)23-11-2-1-10-12(13(11)19)16(3-4-16)15(22)21-10/h1-2,5-6H,3-4,20H2,(H,21,22) |
| InChIKey | DQYROMIKZUEDRV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-amino-2,6-dichlorophenoxy)-4-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-amino-2,6-dichlorophenoxy)-4-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one?
The IUPAC name of 5-(4-amino-2,6-dichlorophenoxy)-4-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one (CID 163293623) is 5-(4-amino-2,6-dichlorophenoxy)-4-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one.
What is the SMILES notation for 5-(4-amino-2,6-dichlorophenoxy)-4-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one?
The canonical SMILES for 5-(4-amino-2,6-dichlorophenoxy)-4-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one is Nc1cc(Cl)c(Oc2ccc3c(c2F)C2(CC2)C(=O)N3)c(Cl)c1.
What is the InChIKey of 5-(4-amino-2,6-dichlorophenoxy)-4-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one?
The InChIKey is DQYROMIKZUEDRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11Cl2FN2O2/c17-8-5-7(20)6-9(18)14(8)23-11-2-1-10-12(13(11)19)16(3-4-16)15(22)21-10/h1-2,5-6H,3-4,20H2,(H,21,22).
What are the key properties of 5-(4-amino-2,6-dichlorophenoxy)-4-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one?
5-(4-amino-2,6-dichlorophenoxy)-4-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one has a molecular weight of 353.18 g/mol, XLogP of 4.49, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-amino-2,6-dichlorophenoxy)-4-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one is sourced from PubChem (CID 163293623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).