C26H27N5O4 — CID 163293729
ethyl N-[2-cyano-2-[[3,5-dimethyl-4-[(2-oxospiro[1H-indole-3,1'-cyclobutane]-5-yl)methyl]phenyl]hydrazinylidene]acetyl]carbamate (PubChem CID 163293729) has the molecular formula C26H27N5O4 and a molecular weight of 473.53 g/mol. Its IUPAC name is ethyl N-[2-cyano-2-[[3,5-dimethyl-4-[(2-oxospiro[1H-indole-3,1'-cyclobutane]-5-yl)methyl]phenyl]hydrazinylidene]acetyl]carbamate.
| Compound Name | ethyl N-[2-cyano-2-[[3,5-dimethyl-4-[(2-oxospiro[1H-indole-3,1'-cyclobutane]-5-yl)methyl]phenyl]hydrazinylidene]acetyl]carbamate |
|---|---|
| PubChem CID | 163293729 |
| Molecular Formula | C26H27N5O4 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | ethyl N-[2-cyano-2-[[3,5-dimethyl-4-[(2-oxospiro[1H-indole-3,1'-cyclobutane]-5-yl)methyl]phenyl]hydrazinylidene]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(C#N)=NNc1cc(C)c(Cc2ccc3c(c2)C2(CCC2)C(=O)N3)c(C)c1 |
| InChI | InChI=1S/C26H27N5O4/c1-4-35-25(34)29-23(32)22(14-27)31-30-18-10-15(2)19(16(3)11-18)12-17-6-7-21-20(13-17)26(8-5-9-26)24(33)28-21/h6-7,10-11,13,30H,4-5,8-9,12H2,1-3H3,(H,28,33)(H,29,32,34) |
| InChIKey | FODGMOCNYOGSRW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|