C21H28F3N7O2 — CID 163293929
[7-amino-6-[(Z)-2-amino-2-(2-hydroxyphenyl)ethenyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-[2-(trifluoromethyl)piperazin-1-yl]methanone (PubChem CID 163293929) has the molecular formula C21H28F3N7O2 and a molecular weight of 467.50 g/mol. Its IUPAC name is [7-amino-6-[(Z)-2-amino-2-(2-hydroxyphenyl)ethenyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-[2-(trifluoromethyl)piperazin-1-yl]methanone.
| Compound Name | [7-amino-6-[(Z)-2-amino-2-(2-hydroxyphenyl)ethenyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-[2-(trifluoromethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 163293929 |
| Molecular Formula | C21H28F3N7O2 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | [7-amino-6-[(Z)-2-amino-2-(2-hydroxyphenyl)ethenyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-[2-(trifluoromethyl)piperazin-1-yl]methanone |
| SMILES | NC1=C(/C=C(\N)c2ccccc2O)N2CCN(C(=O)N3CCNCC3C(F)(F)F)CC2CN1 |
| InChI | InChI=1S/C21H28F3N7O2/c22-21(23,24)18-11-27-5-6-31(18)20(33)29-7-8-30-13(12-29)10-28-19(26)16(30)9-15(25)14-3-1-2-4-17(14)32/h1-4,9,13,18,27-28,32H,5-8,10-12,25-26H2/b15-9- |
| InChIKey | QKOBHWNFMOBVAE-DHDCSXOGSA-N |
| XLogP | 0.37 |
| TPSA | 123.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |