C22H32N6O2 — CID 163294489
[7-amino-6-[(Z)-2-amino-2-(2-hydroxyphenyl)ethenyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-(1-methylpiperidin-4-yl)methanone (PubChem CID 163294489) has the molecular formula C22H32N6O2 and a molecular weight of 412.54 g/mol. Its IUPAC name is [7-amino-6-[(Z)-2-amino-2-(2-hydroxyphenyl)ethenyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-(1-methylpiperidin-4-yl)methanone.
| Compound Name | [7-amino-6-[(Z)-2-amino-2-(2-hydroxyphenyl)ethenyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-(1-methylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 163294489 |
| Molecular Formula | C22H32N6O2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | [7-amino-6-[(Z)-2-amino-2-(2-hydroxyphenyl)ethenyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-(1-methylpiperidin-4-yl)methanone |
| SMILES | CN1CCC(C(=O)N2CCN3C(/C=C(\N)c4ccccc4O)=C(N)NCC3C2)CC1 |
| InChI | InChI=1S/C22H32N6O2/c1-26-8-6-15(7-9-26)22(30)27-10-11-28-16(14-27)13-25-21(24)19(28)12-18(23)17-4-2-3-5-20(17)29/h2-5,12,15-16,25,29H,6-11,13-14,23-24H2,1H3/b18-12- |
| InChIKey | JPUCASMYEBBBKT-PDGQHHTCSA-N |
| XLogP | 0.28 |
| TPSA | 111.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |