C21H30F3N7O2 — CID 163294554
N-[2-[[3-[7-amino-6-[(Z)-2-amino-2-(2-hydroxyphenyl)ethenyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-1,1,1-trifluoropropan-2-yl]amino]ethyl]formamide (PubChem CID 163294554) has the molecular formula C21H30F3N7O2 and a molecular weight of 469.51 g/mol. Its IUPAC name is N-[2-[[3-[7-amino-6-[(Z)-2-amino-2-(2-hydroxyphenyl)ethenyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-1,1,1-trifluoropropan-2-yl]amino]ethyl]formamide.
| Compound Name | N-[2-[[3-[7-amino-6-[(Z)-2-amino-2-(2-hydroxyphenyl)ethenyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-1,1,1-trifluoropropan-2-yl]amino]ethyl]formamide |
|---|---|
| PubChem CID | 163294554 |
| Molecular Formula | C21H30F3N7O2 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | N-[2-[[3-[7-amino-6-[(Z)-2-amino-2-(2-hydroxyphenyl)ethenyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-1,1,1-trifluoropropan-2-yl]amino]ethyl]formamide |
| SMILES | NC1=C(/C=C(\N)c2ccccc2O)N2CCN(CC(NCCNC=O)C(F)(F)F)CC2CN1 |
| InChI | InChI=1S/C21H30F3N7O2/c22-21(23,24)19(28-6-5-27-13-32)12-30-7-8-31-14(11-30)10-29-20(26)17(31)9-16(25)15-3-1-2-4-18(15)33/h1-4,9,13-14,19,28-29,33H,5-8,10-12,25-26H2,(H,27,32)/b16-9- |
| InChIKey | FVOQYCGSJXFQNW-SXGWCWSVSA-N |
| XLogP | -0.32 |
| TPSA | 131.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|