About 1-[(4-amino-3,3-difluoropyrrolidin-1-yl)methyl]cyclopropan-1-ol
1-[(4-amino-3,3-difluoropyrrolidin-1-yl)methyl]cyclopropan-1-ol (PubChem CID 163294804) has the molecular formula C8H14F2N2O
and a molecular weight of 192.21 g/mol. Its IUPAC name is 1-[(4-amino-3,3-difluoropyrrolidin-1-yl)methyl]cyclopropan-1-ol.
Molecular Properties
| Compound Name | 1-[(4-amino-3,3-difluoropyrrolidin-1-yl)methyl]cyclopropan-1-ol |
| PubChem CID | 163294804 |
| Molecular Formula | C8H14F2N2O |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 1-[(4-amino-3,3-difluoropyrrolidin-1-yl)methyl]cyclopropan-1-ol |
| SMILES | NC1CN(CC2(O)CC2)CC1(F)F |
| InChI | InChI=1S/C8H14F2N2O/c9-8(10)5-12(3-6(8)11)4-7(13)1-2-7/h6,13H,1-5,11H2 |
| InChIKey | BDMIJSCSYZOIAY-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(4-amino-3,3-difluoropyrrolidin-1-yl)methyl]cyclopropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-amino-3,3-difluoropyrrolidin-1-yl)methyl]cyclopropan-1-ol?
The IUPAC name of 1-[(4-amino-3,3-difluoropyrrolidin-1-yl)methyl]cyclopropan-1-ol (CID 163294804) is 1-[(4-amino-3,3-difluoropyrrolidin-1-yl)methyl]cyclopropan-1-ol.
What is the SMILES notation for 1-[(4-amino-3,3-difluoropyrrolidin-1-yl)methyl]cyclopropan-1-ol?
The canonical SMILES for 1-[(4-amino-3,3-difluoropyrrolidin-1-yl)methyl]cyclopropan-1-ol is NC1CN(CC2(O)CC2)CC1(F)F.
What is the InChIKey of 1-[(4-amino-3,3-difluoropyrrolidin-1-yl)methyl]cyclopropan-1-ol?
The InChIKey is BDMIJSCSYZOIAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2N2O/c9-8(10)5-12(3-6(8)11)4-7(13)1-2-7/h6,13H,1-5,11H2.
What are the key properties of 1-[(4-amino-3,3-difluoropyrrolidin-1-yl)methyl]cyclopropan-1-ol?
1-[(4-amino-3,3-difluoropyrrolidin-1-yl)methyl]cyclopropan-1-ol has a molecular weight of 192.21 g/mol, XLogP of -0.21, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-amino-3,3-difluoropyrrolidin-1-yl)methyl]cyclopropan-1-ol is sourced from PubChem (CID 163294804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).