C11H10FN3O2 — CID 163295198
methyl 3-(5-fluoro-2-methyl-4-pyridinyl)-1H-pyrazole-5-carboxylate (PubChem CID 163295198) has the molecular formula C11H10FN3O2 and a molecular weight of 235.22 g/mol. Its IUPAC name is methyl 3-(5-fluoro-2-methyl-4-pyridinyl)-1H-pyrazole-5-carboxylate.
| Compound Name | methyl 3-(5-fluoro-2-methyl-4-pyridinyl)-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 163295198 |
| Molecular Formula | C11H10FN3O2 |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | methyl 3-(5-fluoro-2-methyl-4-pyridinyl)-1H-pyrazole-5-carboxylate |
| SMILES | COC(=O)c1cc(-c2cc(C)ncc2F)n[nH]1 |
| InChI | InChI=1S/C11H10FN3O2/c1-6-3-7(8(12)5-13-6)9-4-10(15-14-9)11(16)17-2/h3-5H,1-2H3,(H,14,15) |
| InChIKey | YKYPVODUBRCMDD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |