About [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanol
[8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanol (PubChem CID 163295598) has the molecular formula C10H15F3O3
and a molecular weight of 240.22 g/mol. Its IUPAC name is [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanol.
Molecular Properties
| Compound Name | [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanol |
| PubChem CID | 163295598 |
| Molecular Formula | C10H15F3O3 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanol |
| SMILES | OCC1(C(F)(F)F)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C10H15F3O3/c11-10(12,13)8(7-14)1-3-9(4-2-8)15-5-6-16-9/h14H,1-7H2 |
| InChIKey | OJKISXLRUHIBQX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanol?
The IUPAC name of [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanol (CID 163295598) is [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanol.
What is the SMILES notation for [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanol?
The canonical SMILES for [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanol is OCC1(C(F)(F)F)CCC2(CC1)OCCO2.
What is the InChIKey of [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanol?
The InChIKey is OJKISXLRUHIBQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F3O3/c11-10(12,13)8(7-14)1-3-9(4-2-8)15-5-6-16-9/h14H,1-7H2.
What are the key properties of [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanol?
[8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanol has a molecular weight of 240.22 g/mol, XLogP of 1.84, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanol is sourced from PubChem (CID 163295598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).