C8H10F5NO2 — CID 163295641
4-hydroxyimino-1-(1,1,2,2,2-pentafluoroethyl)cyclohexan-1-ol (PubChem CID 163295641) has the molecular formula C8H10F5NO2 and a molecular weight of 247.16 g/mol. Its IUPAC name is 4-hydroxyimino-1-(1,1,2,2,2-pentafluoroethyl)cyclohexan-1-ol.
| Compound Name | 4-hydroxyimino-1-(1,1,2,2,2-pentafluoroethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 163295641 |
| Molecular Formula | C8H10F5NO2 |
| Molecular Weight | 247.16 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 4-hydroxyimino-1-(1,1,2,2,2-pentafluoroethyl)cyclohexan-1-ol |
| SMILES | ON=C1CCC(O)(C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C8H10F5NO2/c9-7(10,8(11,12)13)6(15)3-1-5(14-16)2-4-6/h15-16H,1-4H2/b14-5- |
| InChIKey | YGTJXWIRFQJEPU-RZNTYIFUSA-N |
| XLogP | 2.32 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.16 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|