About 4-amino-1-(1,1-difluoro-2-hydroxyethyl)cyclohexan-1-ol;hydrochloride
4-amino-1-(1,1-difluoro-2-hydroxyethyl)cyclohexan-1-ol;hydrochloride (PubChem CID 163295718) has the molecular formula C8H16ClF2NO2
and a molecular weight of 231.67 g/mol. Its IUPAC name is 4-amino-1-(1,1-difluoro-2-hydroxyethyl)cyclohexan-1-ol;hydrochloride.
Molecular Properties
| Compound Name | 4-amino-1-(1,1-difluoro-2-hydroxyethyl)cyclohexan-1-ol;hydrochloride |
| PubChem CID | 163295718 |
| Molecular Formula | C8H16ClF2NO2 |
| Molecular Weight | 231.67 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 4-amino-1-(1,1-difluoro-2-hydroxyethyl)cyclohexan-1-ol;hydrochloride |
| SMILES | Cl.NC1CCC(O)(C(F)(F)CO)CC1 |
| InChI | InChI=1S/C8H15F2NO2.ClH/c9-8(10,5-12)7(13)3-1-6(11)2-4-7;/h6,12-13H,1-5,11H2;1H |
| InChIKey | JYWANJZWJBLESC-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.67 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-1-(1,1-difluoro-2-hydroxyethyl)cyclohexan-1-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-(1,1-difluoro-2-hydroxyethyl)cyclohexan-1-ol;hydrochloride?
The IUPAC name of 4-amino-1-(1,1-difluoro-2-hydroxyethyl)cyclohexan-1-ol;hydrochloride (CID 163295718) is 4-amino-1-(1,1-difluoro-2-hydroxyethyl)cyclohexan-1-ol;hydrochloride.
What is the SMILES notation for 4-amino-1-(1,1-difluoro-2-hydroxyethyl)cyclohexan-1-ol;hydrochloride?
The canonical SMILES for 4-amino-1-(1,1-difluoro-2-hydroxyethyl)cyclohexan-1-ol;hydrochloride is Cl.NC1CCC(O)(C(F)(F)CO)CC1.
What is the InChIKey of 4-amino-1-(1,1-difluoro-2-hydroxyethyl)cyclohexan-1-ol;hydrochloride?
The InChIKey is JYWANJZWJBLESC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F2NO2.ClH/c9-8(10,5-12)7(13)3-1-6(11)2-4-7;/h6,12-13H,1-5,11H2;1H.
What are the key properties of 4-amino-1-(1,1-difluoro-2-hydroxyethyl)cyclohexan-1-ol;hydrochloride?
4-amino-1-(1,1-difluoro-2-hydroxyethyl)cyclohexan-1-ol;hydrochloride has a molecular weight of 231.67 g/mol, XLogP of 0.67, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-(1,1-difluoro-2-hydroxyethyl)cyclohexan-1-ol;hydrochloride is sourced from PubChem (CID 163295718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).