About 5-bromo-1H-pyrazole-3-carbaldehyde;1-methylpiperidine-4-carboxylic acid
5-bromo-1H-pyrazole-3-carbaldehyde;1-methylpiperidine-4-carboxylic acid (PubChem CID 163295765) has the molecular formula C11H16BrN3O3
and a molecular weight of 318.17 g/mol. Its IUPAC name is 5-bromo-1H-pyrazole-3-carbaldehyde;1-methylpiperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-bromo-1H-pyrazole-3-carbaldehyde;1-methylpiperidine-4-carboxylic acid |
| PubChem CID | 163295765 |
| Molecular Formula | C11H16BrN3O3 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 5-bromo-1H-pyrazole-3-carbaldehyde;1-methylpiperidine-4-carboxylic acid |
| SMILES | CN1CCC(C(=O)O)CC1.O=Cc1cc(Br)[nH]n1 |
| InChI | InChI=1S/C7H13NO2.C4H3BrN2O/c1-8-4-2-6(3-5-8)7(9)10;5-4-1-3(2-8)6-7-4/h6H,2-5H2,1H3,(H,9,10);1-2H,(H,6,7) |
| InChIKey | DRSCZSKXFNDXKT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-1H-pyrazole-3-carbaldehyde;1-methylpiperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1H-pyrazole-3-carbaldehyde;1-methylpiperidine-4-carboxylic acid?
The IUPAC name of 5-bromo-1H-pyrazole-3-carbaldehyde;1-methylpiperidine-4-carboxylic acid (CID 163295765) is 5-bromo-1H-pyrazole-3-carbaldehyde;1-methylpiperidine-4-carboxylic acid.
What is the SMILES notation for 5-bromo-1H-pyrazole-3-carbaldehyde;1-methylpiperidine-4-carboxylic acid?
The canonical SMILES for 5-bromo-1H-pyrazole-3-carbaldehyde;1-methylpiperidine-4-carboxylic acid is CN1CCC(C(=O)O)CC1.O=Cc1cc(Br)[nH]n1.
What is the InChIKey of 5-bromo-1H-pyrazole-3-carbaldehyde;1-methylpiperidine-4-carboxylic acid?
The InChIKey is DRSCZSKXFNDXKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.C4H3BrN2O/c1-8-4-2-6(3-5-8)7(9)10;5-4-1-3(2-8)6-7-4/h6H,2-5H2,1H3,(H,9,10);1-2H,(H,6,7).
What are the key properties of 5-bromo-1H-pyrazole-3-carbaldehyde;1-methylpiperidine-4-carboxylic acid?
5-bromo-1H-pyrazole-3-carbaldehyde;1-methylpiperidine-4-carboxylic acid has a molecular weight of 318.17 g/mol, XLogP of 1.40, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1H-pyrazole-3-carbaldehyde;1-methylpiperidine-4-carboxylic acid is sourced from PubChem (CID 163295765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).