C6H4O4 — CID 163296647
ethene-1,1,2,2-tetracarbaldehyde (PubChem CID 163296647) has the molecular formula C6H4O4 and a molecular weight of 140.09 g/mol. Its IUPAC name is ethene-1,1,2,2-tetracarbaldehyde.
| Compound Name | ethene-1,1,2,2-tetracarbaldehyde |
|---|---|
| PubChem CID | 163296647 |
| Molecular Formula | C6H4O4 |
| Molecular Weight | 140.09 g/mol |
| Exact Mass | 140.01 |
| IUPAC Name | ethene-1,1,2,2-tetracarbaldehyde |
| SMILES | O=CC(C=O)=C(C=O)C=O |
| InChI | InChI=1S/C6H4O4/c7-1-5(2-8)6(3-9)4-10/h1-4H |
| InChIKey | NISDJYLFAPBDPG-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.09 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|