C28H25N5OS — CID 163296711
1-[[4-[5-(1-methylindazol-6-yl)-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraen-10-yl]phenyl]methyl]piperidin-2-one (PubChem CID 163296711) has the molecular formula C28H25N5OS and a molecular weight of 479.61 g/mol. Its IUPAC name is 1-[[4-[5-(1-methylindazol-6-yl)-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraen-10-yl]phenyl]methyl]piperidin-2-one.
| Compound Name | 1-[[4-[5-(1-methylindazol-6-yl)-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraen-10-yl]phenyl]methyl]piperidin-2-one |
|---|---|
| PubChem CID | 163296711 |
| Molecular Formula | C28H25N5OS |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 1-[[4-[5-(1-methylindazol-6-yl)-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraen-10-yl]phenyl]methyl]piperidin-2-one |
| SMILES | Cn1ncc2ccc(-c3n[nH]c4c3Cc3sc(-c5ccc(CN6CCCCC6=O)cc5)cc3-4)cc21 |
| InChI | InChI=1S/C28H25N5OS/c1-32-23-12-19(9-10-20(23)15-29-32)27-22-14-25-21(28(22)31-30-27)13-24(35-25)18-7-5-17(6-8-18)16-33-11-3-2-4-26(33)34/h5-10,12-13,15H,2-4,11,14,16H2,1H3,(H,30,31) |
| InChIKey | ARYBUHMWHJXNIC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |