C26H21F2N5S — CID 163296718
10-[4-[(3,3-difluoroazetidin-1-yl)methyl]phenyl]-5-(1-methylindazol-6-yl)-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraene (PubChem CID 163296718) has the molecular formula C26H21F2N5S and a molecular weight of 473.55 g/mol. Its IUPAC name is 10-[4-[(3,3-difluoroazetidin-1-yl)methyl]phenyl]-5-(1-methylindazol-6-yl)-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraene.
| Compound Name | 10-[4-[(3,3-difluoroazetidin-1-yl)methyl]phenyl]-5-(1-methylindazol-6-yl)-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraene |
|---|---|
| PubChem CID | 163296718 |
| Molecular Formula | C26H21F2N5S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 10-[4-[(3,3-difluoroazetidin-1-yl)methyl]phenyl]-5-(1-methylindazol-6-yl)-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraene |
| SMILES | Cn1ncc2ccc(-c3n[nH]c4c3Cc3sc(-c5ccc(CN6CC(F)(F)C6)cc5)cc3-4)cc21 |
| InChI | InChI=1S/C26H21F2N5S/c1-32-21-8-17(6-7-18(21)11-29-32)24-20-10-23-19(25(20)31-30-24)9-22(34-23)16-4-2-15(3-5-16)12-33-13-26(27,28)14-33/h2-9,11H,10,12-14H2,1H3,(H,30,31) |
| InChIKey | OIQAGDXYNWJBKC-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |