C13H9ClN4OS — CID 163297395
2-(6-chloro-2-methylimidazo[1,2-a]pyridin-3-yl)-5-prop-2-ynylsulfanyl-1,3,4-oxadiazole (PubChem CID 163297395) has the molecular formula C13H9ClN4OS and a molecular weight of 304.76 g/mol. Its IUPAC name is 2-(6-chloro-2-methylimidazo[1,2-a]pyridin-3-yl)-5-prop-2-ynylsulfanyl-1,3,4-oxadiazole.
| Compound Name | 2-(6-chloro-2-methylimidazo[1,2-a]pyridin-3-yl)-5-prop-2-ynylsulfanyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 163297395 |
| Molecular Formula | C13H9ClN4OS |
| Molecular Weight | 304.76 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 2-(6-chloro-2-methylimidazo[1,2-a]pyridin-3-yl)-5-prop-2-ynylsulfanyl-1,3,4-oxadiazole |
| SMILES | C#CCSc1nnc(-c2c(C)nc3ccc(Cl)cn23)o1 |
| InChI | InChI=1S/C13H9ClN4OS/c1-3-6-20-13-17-16-12(19-13)11-8(2)15-10-5-4-9(14)7-18(10)11/h1,4-5,7H,6H2,2H3 |
| InChIKey | BHTIIOLLNOFALY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.76 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|