About 4-[5-(benzenesulfonyl)-5,5-difluoropentoxy]chromen-2-one
4-[5-(benzenesulfonyl)-5,5-difluoropentoxy]chromen-2-one (PubChem CID 163297654) has the molecular formula C20H18F2O5S
and a molecular weight of 408.42 g/mol. Its IUPAC name is 4-[5-(benzenesulfonyl)-5,5-difluoropentoxy]chromen-2-one.
Molecular Properties
| Compound Name | 4-[5-(benzenesulfonyl)-5,5-difluoropentoxy]chromen-2-one |
| PubChem CID | 163297654 |
| Molecular Formula | C20H18F2O5S |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 4-[5-(benzenesulfonyl)-5,5-difluoropentoxy]chromen-2-one |
| SMILES | O=c1cc(OCCCCC(F)(F)S(=O)(=O)c2ccccc2)c2ccccc2o1 |
| InChI | InChI=1S/C20H18F2O5S/c21-20(22,28(24,25)15-8-2-1-3-9-15)12-6-7-13-26-18-14-19(23)27-17-11-5-4-10-16(17)18/h1-5,8-11,14H,6-7,12-13H2 |
| InChIKey | FTYJOCIBQPPIGE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-(benzenesulfonyl)-5,5-difluoropentoxy]chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(benzenesulfonyl)-5,5-difluoropentoxy]chromen-2-one?
The IUPAC name of 4-[5-(benzenesulfonyl)-5,5-difluoropentoxy]chromen-2-one (CID 163297654) is 4-[5-(benzenesulfonyl)-5,5-difluoropentoxy]chromen-2-one.
What is the SMILES notation for 4-[5-(benzenesulfonyl)-5,5-difluoropentoxy]chromen-2-one?
The canonical SMILES for 4-[5-(benzenesulfonyl)-5,5-difluoropentoxy]chromen-2-one is O=c1cc(OCCCCC(F)(F)S(=O)(=O)c2ccccc2)c2ccccc2o1.
What is the InChIKey of 4-[5-(benzenesulfonyl)-5,5-difluoropentoxy]chromen-2-one?
The InChIKey is FTYJOCIBQPPIGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18F2O5S/c21-20(22,28(24,25)15-8-2-1-3-9-15)12-6-7-13-26-18-14-19(23)27-17-11-5-4-10-16(17)18/h1-5,8-11,14H,6-7,12-13H2.
What are the key properties of 4-[5-(benzenesulfonyl)-5,5-difluoropentoxy]chromen-2-one?
4-[5-(benzenesulfonyl)-5,5-difluoropentoxy]chromen-2-one has a molecular weight of 408.42 g/mol, XLogP of 4.41, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(benzenesulfonyl)-5,5-difluoropentoxy]chromen-2-one is sourced from PubChem (CID 163297654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).