C19H20F2O4S — CID 163297658
[6-(benzenesulfonyl)-6,6-difluorohexyl] benzoate (PubChem CID 163297658) has the molecular formula C19H20F2O4S and a molecular weight of 382.43 g/mol. Its IUPAC name is [6-(benzenesulfonyl)-6,6-difluorohexyl] benzoate.
| Compound Name | [6-(benzenesulfonyl)-6,6-difluorohexyl] benzoate |
|---|---|
| PubChem CID | 163297658 |
| Molecular Formula | C19H20F2O4S |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | [6-(benzenesulfonyl)-6,6-difluorohexyl] benzoate |
| SMILES | O=C(OCCCCCC(F)(F)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20F2O4S/c20-19(21,26(23,24)17-12-6-2-7-13-17)14-8-3-9-15-25-18(22)16-10-4-1-5-11-16/h1-2,4-7,10-13H,3,8-9,14-15H2 |
| InChIKey | BCBBBOCZSCYRJG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|