About benzyl 3-(2-ethoxy-1,1-difluoro-2-oxoethyl)pyrrolidine-1-carboxylate
benzyl 3-(2-ethoxy-1,1-difluoro-2-oxoethyl)pyrrolidine-1-carboxylate (PubChem CID 163297662) has the molecular formula C16H19F2NO4
and a molecular weight of 327.33 g/mol. Its IUPAC name is benzyl 3-(2-ethoxy-1,1-difluoro-2-oxoethyl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | benzyl 3-(2-ethoxy-1,1-difluoro-2-oxoethyl)pyrrolidine-1-carboxylate |
| PubChem CID | 163297662 |
| Molecular Formula | C16H19F2NO4 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | benzyl 3-(2-ethoxy-1,1-difluoro-2-oxoethyl)pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)C(F)(F)C1CCN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C16H19F2NO4/c1-2-22-14(20)16(17,18)13-8-9-19(10-13)15(21)23-11-12-6-4-3-5-7-12/h3-7,13H,2,8-11H2,1H3 |
| InChIKey | ZYHRMAMJYNQFGA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl 3-(2-ethoxy-1,1-difluoro-2-oxoethyl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 3-(2-ethoxy-1,1-difluoro-2-oxoethyl)pyrrolidine-1-carboxylate?
The IUPAC name of benzyl 3-(2-ethoxy-1,1-difluoro-2-oxoethyl)pyrrolidine-1-carboxylate (CID 163297662) is benzyl 3-(2-ethoxy-1,1-difluoro-2-oxoethyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for benzyl 3-(2-ethoxy-1,1-difluoro-2-oxoethyl)pyrrolidine-1-carboxylate?
The canonical SMILES for benzyl 3-(2-ethoxy-1,1-difluoro-2-oxoethyl)pyrrolidine-1-carboxylate is CCOC(=O)C(F)(F)C1CCN(C(=O)OCc2ccccc2)C1.
What is the InChIKey of benzyl 3-(2-ethoxy-1,1-difluoro-2-oxoethyl)pyrrolidine-1-carboxylate?
The InChIKey is ZYHRMAMJYNQFGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F2NO4/c1-2-22-14(20)16(17,18)13-8-9-19(10-13)15(21)23-11-12-6-4-3-5-7-12/h3-7,13H,2,8-11H2,1H3.
What are the key properties of benzyl 3-(2-ethoxy-1,1-difluoro-2-oxoethyl)pyrrolidine-1-carboxylate?
benzyl 3-(2-ethoxy-1,1-difluoro-2-oxoethyl)pyrrolidine-1-carboxylate has a molecular weight of 327.33 g/mol, XLogP of 2.84, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-(2-ethoxy-1,1-difluoro-2-oxoethyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 163297662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).