C12H16F2O2S — CID 163297663
(1,1-difluoro-2,3-dimethylbutyl)sulfonylbenzene (PubChem CID 163297663) has the molecular formula C12H16F2O2S and a molecular weight of 262.32 g/mol. Its IUPAC name is (1,1-difluoro-2,3-dimethylbutyl)sulfonylbenzene.
| Compound Name | (1,1-difluoro-2,3-dimethylbutyl)sulfonylbenzene |
|---|---|
| PubChem CID | 163297663 |
| Molecular Formula | C12H16F2O2S |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | (1,1-difluoro-2,3-dimethylbutyl)sulfonylbenzene |
| SMILES | CC(C)C(C)C(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H16F2O2S/c1-9(2)10(3)12(13,14)17(15,16)11-7-5-4-6-8-11/h4-10H,1-3H3 |
| InChIKey | IQULJJONAPTSDW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |