C21H15F19O4S — CID 163297679
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 4-(benzenesulfonyl)-4,4-difluoro-2-methylbutanoate (PubChem CID 163297679) has the molecular formula C21H15F19O4S and a molecular weight of 724.38 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 4-(benzenesulfonyl)-4,4-difluoro-2-methylbutanoate.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 4-(benzenesulfonyl)-4,4-difluoro-2-methylbutanoate |
|---|---|
| PubChem CID | 163297679 |
| Molecular Formula | C21H15F19O4S |
| Molecular Weight | 724.38 g/mol |
| Exact Mass | 724.04 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 4-(benzenesulfonyl)-4,4-difluoro-2-methylbutanoate |
| SMILES | CC(CC(F)(F)S(=O)(=O)c1ccccc1)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H15F19O4S/c1-10(9-14(24,25)45(42,43)11-5-3-2-4-6-11)12(41)44-8-7-13(22,23)15(26,27)16(28,29)17(30,31)18(32,33)19(34,35)20(36,37)21(38,39)40/h2-6,10H,7-9H2,1H3 |
| InChIKey | KTSATYWYLPDYHD-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.38 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|