About (1,1-difluoro-4,4-dimethylpentyl)sulfonylbenzene
(1,1-difluoro-4,4-dimethylpentyl)sulfonylbenzene (PubChem CID 163297685) has the molecular formula C13H18F2O2S
and a molecular weight of 276.35 g/mol. Its IUPAC name is (1,1-difluoro-4,4-dimethylpentyl)sulfonylbenzene.
Molecular Properties
| Compound Name | (1,1-difluoro-4,4-dimethylpentyl)sulfonylbenzene |
| PubChem CID | 163297685 |
| Molecular Formula | C13H18F2O2S |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (1,1-difluoro-4,4-dimethylpentyl)sulfonylbenzene |
| SMILES | CC(C)(C)CCC(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H18F2O2S/c1-12(2,3)9-10-13(14,15)18(16,17)11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3 |
| InChIKey | PUFSXXPAWRUGOT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1,1-difluoro-4,4-dimethylpentyl)sulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,1-difluoro-4,4-dimethylpentyl)sulfonylbenzene?
The IUPAC name of (1,1-difluoro-4,4-dimethylpentyl)sulfonylbenzene (CID 163297685) is (1,1-difluoro-4,4-dimethylpentyl)sulfonylbenzene.
What is the SMILES notation for (1,1-difluoro-4,4-dimethylpentyl)sulfonylbenzene?
The canonical SMILES for (1,1-difluoro-4,4-dimethylpentyl)sulfonylbenzene is CC(C)(C)CCC(F)(F)S(=O)(=O)c1ccccc1.
What is the InChIKey of (1,1-difluoro-4,4-dimethylpentyl)sulfonylbenzene?
The InChIKey is PUFSXXPAWRUGOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F2O2S/c1-12(2,3)9-10-13(14,15)18(16,17)11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3.
What are the key properties of (1,1-difluoro-4,4-dimethylpentyl)sulfonylbenzene?
(1,1-difluoro-4,4-dimethylpentyl)sulfonylbenzene has a molecular weight of 276.35 g/mol, XLogP of 3.88, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1,1-difluoro-4,4-dimethylpentyl)sulfonylbenzene is sourced from PubChem (CID 163297685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).