About [5-(benzenesulfonyl)-5,5-difluoropentyl] cyclohexanecarboxylate
[5-(benzenesulfonyl)-5,5-difluoropentyl] cyclohexanecarboxylate (PubChem CID 163297687) has the molecular formula C18H24F2O4S
and a molecular weight of 374.45 g/mol. Its IUPAC name is [5-(benzenesulfonyl)-5,5-difluoropentyl] cyclohexanecarboxylate.
Molecular Properties
| Compound Name | [5-(benzenesulfonyl)-5,5-difluoropentyl] cyclohexanecarboxylate |
| PubChem CID | 163297687 |
| Molecular Formula | C18H24F2O4S |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | [5-(benzenesulfonyl)-5,5-difluoropentyl] cyclohexanecarboxylate |
| SMILES | O=C(OCCCCC(F)(F)S(=O)(=O)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C18H24F2O4S/c19-18(20,25(22,23)16-11-5-2-6-12-16)13-7-8-14-24-17(21)15-9-3-1-4-10-15/h2,5-6,11-12,15H,1,3-4,7-10,13-14H2 |
| InChIKey | YYAKYUCANPQWMO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [5-(benzenesulfonyl)-5,5-difluoropentyl] cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(benzenesulfonyl)-5,5-difluoropentyl] cyclohexanecarboxylate?
The IUPAC name of [5-(benzenesulfonyl)-5,5-difluoropentyl] cyclohexanecarboxylate (CID 163297687) is [5-(benzenesulfonyl)-5,5-difluoropentyl] cyclohexanecarboxylate.
What is the SMILES notation for [5-(benzenesulfonyl)-5,5-difluoropentyl] cyclohexanecarboxylate?
The canonical SMILES for [5-(benzenesulfonyl)-5,5-difluoropentyl] cyclohexanecarboxylate is O=C(OCCCCC(F)(F)S(=O)(=O)c1ccccc1)C1CCCCC1.
What is the InChIKey of [5-(benzenesulfonyl)-5,5-difluoropentyl] cyclohexanecarboxylate?
The InChIKey is YYAKYUCANPQWMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24F2O4S/c19-18(20,25(22,23)16-11-5-2-6-12-16)13-7-8-14-24-17(21)15-9-3-1-4-10-15/h2,5-6,11-12,15H,1,3-4,7-10,13-14H2.
What are the key properties of [5-(benzenesulfonyl)-5,5-difluoropentyl] cyclohexanecarboxylate?
[5-(benzenesulfonyl)-5,5-difluoropentyl] cyclohexanecarboxylate has a molecular weight of 374.45 g/mol, XLogP of 4.35, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(benzenesulfonyl)-5,5-difluoropentyl] cyclohexanecarboxylate is sourced from PubChem (CID 163297687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).