C13H17ClF2O2S — CID 163297693
(7-chloro-1,1-difluoroheptyl)sulfonylbenzene (PubChem CID 163297693) has the molecular formula C13H17ClF2O2S and a molecular weight of 310.79 g/mol. Its IUPAC name is (7-chloro-1,1-difluoroheptyl)sulfonylbenzene.
| Compound Name | (7-chloro-1,1-difluoroheptyl)sulfonylbenzene |
|---|---|
| PubChem CID | 163297693 |
| Molecular Formula | C13H17ClF2O2S |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | (7-chloro-1,1-difluoroheptyl)sulfonylbenzene |
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)CCCCCCCl |
| InChI | InChI=1S/C13H17ClF2O2S/c14-11-7-2-1-6-10-13(15,16)19(17,18)12-8-4-3-5-9-12/h3-5,8-9H,1-2,6-7,10-11H2 |
| InChIKey | WULYRPRXKSIQBE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|