About (7-chloro-1,1-difluoroheptyl)sulfonylbenzene
(7-chloro-1,1-difluoroheptyl)sulfonylbenzene (PubChem CID 163297693) has the molecular formula C13H17ClF2O2S
and a molecular weight of 310.79 g/mol. Its IUPAC name is (7-chloro-1,1-difluoroheptyl)sulfonylbenzene.
Molecular Properties
| Compound Name | (7-chloro-1,1-difluoroheptyl)sulfonylbenzene |
| PubChem CID | 163297693 |
| Molecular Formula | C13H17ClF2O2S |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | (7-chloro-1,1-difluoroheptyl)sulfonylbenzene |
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)CCCCCCCl |
| InChI | InChI=1S/C13H17ClF2O2S/c14-11-7-2-1-6-10-13(15,16)19(17,18)12-8-4-3-5-9-12/h3-5,8-9H,1-2,6-7,10-11H2 |
| InChIKey | WULYRPRXKSIQBE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (7-chloro-1,1-difluoroheptyl)sulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-chloro-1,1-difluoroheptyl)sulfonylbenzene?
The IUPAC name of (7-chloro-1,1-difluoroheptyl)sulfonylbenzene (CID 163297693) is (7-chloro-1,1-difluoroheptyl)sulfonylbenzene.
What is the SMILES notation for (7-chloro-1,1-difluoroheptyl)sulfonylbenzene?
The canonical SMILES for (7-chloro-1,1-difluoroheptyl)sulfonylbenzene is O=S(=O)(c1ccccc1)C(F)(F)CCCCCCCl.
What is the InChIKey of (7-chloro-1,1-difluoroheptyl)sulfonylbenzene?
The InChIKey is WULYRPRXKSIQBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClF2O2S/c14-11-7-2-1-6-10-13(15,16)19(17,18)12-8-4-3-5-9-12/h3-5,8-9H,1-2,6-7,10-11H2.
What are the key properties of (7-chloro-1,1-difluoroheptyl)sulfonylbenzene?
(7-chloro-1,1-difluoroheptyl)sulfonylbenzene has a molecular weight of 310.79 g/mol, XLogP of 4.24, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7-chloro-1,1-difluoroheptyl)sulfonylbenzene is sourced from PubChem (CID 163297693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).