About tert-butyl N-[5-(benzenesulfonyl)-5,5-difluoropentyl]carbamate
tert-butyl N-[5-(benzenesulfonyl)-5,5-difluoropentyl]carbamate (PubChem CID 163297722) has the molecular formula C16H23F2NO4S
and a molecular weight of 363.43 g/mol. Its IUPAC name is tert-butyl N-[5-(benzenesulfonyl)-5,5-difluoropentyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[5-(benzenesulfonyl)-5,5-difluoropentyl]carbamate |
| PubChem CID | 163297722 |
| Molecular Formula | C16H23F2NO4S |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | tert-butyl N-[5-(benzenesulfonyl)-5,5-difluoropentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCC(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H23F2NO4S/c1-15(2,3)23-14(20)19-12-8-7-11-16(17,18)24(21,22)13-9-5-4-6-10-13/h4-6,9-10H,7-8,11-12H2,1-3H3,(H,19,20) |
| InChIKey | NUNFPFARZGRKAK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[5-(benzenesulfonyl)-5,5-difluoropentyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[5-(benzenesulfonyl)-5,5-difluoropentyl]carbamate?
The IUPAC name of tert-butyl N-[5-(benzenesulfonyl)-5,5-difluoropentyl]carbamate (CID 163297722) is tert-butyl N-[5-(benzenesulfonyl)-5,5-difluoropentyl]carbamate.
What is the SMILES notation for tert-butyl N-[5-(benzenesulfonyl)-5,5-difluoropentyl]carbamate?
The canonical SMILES for tert-butyl N-[5-(benzenesulfonyl)-5,5-difluoropentyl]carbamate is CC(C)(C)OC(=O)NCCCCC(F)(F)S(=O)(=O)c1ccccc1.
What is the InChIKey of tert-butyl N-[5-(benzenesulfonyl)-5,5-difluoropentyl]carbamate?
The InChIKey is NUNFPFARZGRKAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23F2NO4S/c1-15(2,3)23-14(20)19-12-8-7-11-16(17,18)24(21,22)13-9-5-4-6-10-13/h4-6,9-10H,7-8,11-12H2,1-3H3,(H,19,20).
What are the key properties of tert-butyl N-[5-(benzenesulfonyl)-5,5-difluoropentyl]carbamate?
tert-butyl N-[5-(benzenesulfonyl)-5,5-difluoropentyl]carbamate has a molecular weight of 363.43 g/mol, XLogP of 3.75, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[5-(benzenesulfonyl)-5,5-difluoropentyl]carbamate is sourced from PubChem (CID 163297722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).