C19H22F2O5S2 — CID 163297727
[6-(benzenesulfonyl)-6,6-difluorohexyl] 4-methylbenzenesulfonate (PubChem CID 163297727) has the molecular formula C19H22F2O5S2 and a molecular weight of 432.51 g/mol. Its IUPAC name is [6-(benzenesulfonyl)-6,6-difluorohexyl] 4-methylbenzenesulfonate.
| Compound Name | [6-(benzenesulfonyl)-6,6-difluorohexyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 163297727 |
| Molecular Formula | C19H22F2O5S2 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | [6-(benzenesulfonyl)-6,6-difluorohexyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCCC(F)(F)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H22F2O5S2/c1-16-10-12-18(13-11-16)28(24,25)26-15-7-3-6-14-19(20,21)27(22,23)17-8-4-2-5-9-17/h2,4-5,8-13H,3,6-7,14-15H2,1H3 |
| InChIKey | NWGIYHRHXAOINC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|