C19H20F2O5S — CID 163297773
[5-(benzenesulfonyl)-5,5-difluoropentyl] 4-methoxybenzoate (PubChem CID 163297773) has the molecular formula C19H20F2O5S and a molecular weight of 398.43 g/mol. Its IUPAC name is [5-(benzenesulfonyl)-5,5-difluoropentyl] 4-methoxybenzoate.
| Compound Name | [5-(benzenesulfonyl)-5,5-difluoropentyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 163297773 |
| Molecular Formula | C19H20F2O5S |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | [5-(benzenesulfonyl)-5,5-difluoropentyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCCCCC(F)(F)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H20F2O5S/c1-25-16-11-9-15(10-12-16)18(22)26-14-6-5-13-19(20,21)27(23,24)17-7-3-2-4-8-17/h2-4,7-12H,5-6,13-14H2,1H3 |
| InChIKey | HSWIMWYZABJHCS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|