C20H19F5O4S — CID 163297783
[5,5-difluoro-5-[4-(trifluoromethyl)phenyl]sulfonylpentyl] 4-methylbenzoate (PubChem CID 163297783) has the molecular formula C20H19F5O4S and a molecular weight of 450.43 g/mol. Its IUPAC name is [5,5-difluoro-5-[4-(trifluoromethyl)phenyl]sulfonylpentyl] 4-methylbenzoate.
| Compound Name | [5,5-difluoro-5-[4-(trifluoromethyl)phenyl]sulfonylpentyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 163297783 |
| Molecular Formula | C20H19F5O4S |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | [5,5-difluoro-5-[4-(trifluoromethyl)phenyl]sulfonylpentyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCCCCC(F)(F)S(=O)(=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H19F5O4S/c1-14-4-6-15(7-5-14)18(26)29-13-3-2-12-19(21,22)30(27,28)17-10-8-16(9-11-17)20(23,24)25/h4-11H,2-3,12-13H2,1H3 |
| InChIKey | CJHMWEXTONAKAQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|