C17H17NO4 — CID 163297838
prop-2-enyl (1R,8S,11S)-11-acetyloxy-3-azatricyclo[6.4.0.02,7]dodeca-2(7),3,5,9-tetraene-1-carboxylate (PubChem CID 163297838) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is prop-2-enyl (1R,8S,11S)-11-acetyloxy-3-azatricyclo[6.4.0.02,7]dodeca-2(7),3,5,9-tetraene-1-carboxylate.
| Compound Name | prop-2-enyl (1R,8S,11S)-11-acetyloxy-3-azatricyclo[6.4.0.02,7]dodeca-2(7),3,5,9-tetraene-1-carboxylate |
|---|---|
| PubChem CID | 163297838 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | prop-2-enyl (1R,8S,11S)-11-acetyloxy-3-azatricyclo[6.4.0.02,7]dodeca-2(7),3,5,9-tetraene-1-carboxylate |
| SMILES | C=CCOC(=O)[C@]12C[C@H](OC(C)=O)C=C[C@H]1c1cccnc12 |
| InChI | InChI=1S/C17H17NO4/c1-3-9-21-16(20)17-10-12(22-11(2)19)6-7-14(17)13-5-4-8-18-15(13)17/h3-8,12,14H,1,9-10H2,2H3/t12-,14+,17-/m1/s1 |
| InChIKey | YTDBKBMRUNCKGU-HACGYAERSA-N |
| XLogP | 2.04 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|